Drugs present in MMsINC which are similar to the molecule MMscode: MMs02841305
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.75 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725733![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725734![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.70 |
MMs01725536![]() | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.70 |