Drugs present in MMsINC which are similar to the molecule MMscode: MMs02836601
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.74 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01727179![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.70 |
MMs01727180![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.70 |








