Drugs present in MMsINC which are similar to the molecule MMscode: MMs02821890
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.77 |
MMs01724806![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.75 |
MMs01725741![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.75 |
MMs01724849![]() | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.74 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01724746![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.70 |










