Drugs present in MMsINC which are similar to the molecule MMscode: MMs02813276
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726808![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.82 |
MMs01726810![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.82 |
MMs01726812![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.82 |





