Drugs present in MMsINC which are similar to the molecule MMscode: MMs02813081
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725108![]() | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.81 |
MMs01725448![]() | Oc1cc(ccc1O)CC(N)C(O)=O | 0.80 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.76 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.74 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.74 |
MMs01726519![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01725392![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01726518![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01724743![]() | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |