Drugs present in MMsINC which are similar to the molecule MMscode: MMs02806290
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725559 | O(CCCCCOc1ccc(cc1)C(N)=N)c1ccc(cc1)C(N)=N | 0.87 |
MMs01725619 | O(C(=O)C(C)C)c1cc(ccc1OC(=O)C(C)C)CCNC | 0.73 |
MMs01724895 | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 0.73 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.70 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.70 |