Drugs present in MMsINC which are similar to the molecule MMscode: MMs02805316
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727039![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |
MMs01727040![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |
MMs01727041![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |
MMs01726155![]() | OC1(CCC2C3C(CCC12C)C1(C(=CC(=O)CC1)C=C3)C)CCC(O)=O | 0.71 |
MMs01726161![]() | OC1(CCC2C3C(CCC12C)C1(C(=CC(=O)CC1)C=C3)C)CCC(O)=O | 0.71 |
MMs01726157![]() | OC1(CCC2C3C(CCC12C)C1(C(=CC(=O)CC1)C=C3)C)CCC(O)=O | 0.71 |
MMs01726159![]() | OC1(CCC2C3C(CCC12C)C1(C(=CC(=O)CC1)C=C3)C)CCC(O)=O | 0.71 |