Drugs present in MMsINC which are similar to the molecule MMscode: MMs02802552
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725170![]() | s1c2c(ccc(O)c2)c(C(=O)c2ccc(OCCN3CCCCC3)cc2)c1-c1ccc(O)cc1 | 0.73 |
MMs01727198![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727200![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727202![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |
MMs01727204![]() | Fc1ccc(cc1)C1CCNCC1OCc1cc2OCOc2cc1 | 0.70 |