Drugs present in MMsINC which are similar to the molecule MMscode: MMs02786347
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.75 |
MMs01724780![]() | O(C)c1ccccc1CC(NC)C | 0.74 |
MMs01725116![]() | O(C)c1ccccc1CC(NC)C | 0.74 |
MMs01724733![]() | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.74 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.73 |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.72 |
MMs01724837![]() | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.72 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.72 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.72 |
MMs01725838![]() | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.71 |