Drugs present in MMsINC which are similar to the molecule MMscode: MMs02735108
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.77 |
MMs01725830![]() | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.77 |
MMs01725048![]() | O(C(=O)NC)c1cc2c(N(C3N(CCC23C)C)C)cc1 | 0.75 |
MMs01725723![]() | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.73 |
MMs01724841![]() | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.72 |
MMs01725388![]() | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.71 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |