Drugs present in MMsINC which are similar to the molecule MMscode: MMs02650671
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725427![]() | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.81 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.75 |
MMs01724845![]() | Brc1ccccc1C[N+](CC)(C)C | 0.75 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01725660![]() | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01725393![]() | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01725440![]() | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.70 |
MMs01725549![]() | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01724888![]() | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.70 |