Drugs present in MMsINC which are similar to the molecule MMscode: MMs02649798
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.74 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |