Drugs present in MMsINC which are similar to the molecule MMscode: MMs02648586
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.78 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.78 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.76 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.73 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.72 |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.71 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.70 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.70 |