Drugs present in MMsINC which are similar to the molecule MMscode: MMs02644213
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.79 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.76 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.70 |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01725390 | [NH+](CCC=C1c2c(CCc3c1cccc3)cccc2)(C)C | 0.70 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725395 | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |