Drugs present in MMsINC which are similar to the molecule MMscode: MMs02636414
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724760 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01725155 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01725156 | S(=O)(=O)(NC(=O)NN1CC2C(CCC2)C1)c1ccc(cc1)C | 0.71 |
MMs01725091 | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.71 |
MMs01725434 | [NH2+](CC12CCC(c3c1cccc3)c1c2cccc1)C | 0.70 |