Drugs present in MMsINC which are similar to the molecule MMscode: MMs02635843
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725859 | Oc1c(O)c(c2c(cc(C)c(-c3c(cc4c(c(C=O)c(O)c(O)c4C(C)C)c3O)C)c2O)c1C(C)C)C=O | 0.80 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.73 |
MMs01724776 | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.73 |
MMs01726519 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01725392 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01726518 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01724743 | O(C(=O)C(O)c1ccccc1)C1CC(CC(C1)C)(C)C | 0.73 |
MMs01725451 | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.72 |
MMs01725139 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01725137 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |
MMs01724767 | Oc1ccc(cc1C(=O)N)C(O)CNC(CCc1ccccc1)C | 0.70 |