Drugs present in MMsINC which are similar to the molecule MMscode: MMs02626463
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.79 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.78 |
MMs01726749 | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.77 |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.74 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.72 |
MMs01725777 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01727511 | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.71 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |
MMs01725757 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725759 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725761 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725763 | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725723 | O(CC(O)CNC(C)(C)C)c1ccc(NC(=O)N(CC)CC)cc1C(=O)C | 0.70 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.70 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.70 |