Drugs present in MMsINC which are similar to the molecule MMscode: MMs02616233
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.71 |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.71 |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.70 |
MMs01724741 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.70 |
MMs01726475 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.70 |