Drugs present in MMsINC which are similar to the molecule MMscode: MMs02614419
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.75 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.75 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.73 |
MMs01725429 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.72 |
MMs01725443 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.72 |
MMs01725047 | S(=O)(=O)(Nc1ncc(OC)cn1)c1ccc(N)cc1 | 0.71 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.70 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.70 |
MMs01725449 | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.70 |
MMs01725694 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.70 |
MMs01725013 | O=C(N(C(CN1CCCCC1)C)c1ncccc1)CC | 0.70 |
MMs01725638 | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.70 |
MMs01725790 | OC(=O)C(NC(=O)c1ccc(NCc2nc3c(nc(nc3N)N)nc2)cc1)CCC(O)=O | 0.70 |