Drugs present in MMsINC which are similar to the molecule MMscode: MMs02614116
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01724929 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.73 |
MMs01726926 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.73 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.71 |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.70 |