Drugs present in MMsINC which are similar to the molecule MMscode: MMs02523751
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.78 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01725647![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.75 |
MMs01725091![]() | S(=O)(=O)(NC(=O)NN1CCCCCC1)c1ccc(cc1)C | 0.71 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.71 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725564![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725565![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.71 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.70 |