Drugs present in MMsINC which are similar to the molecule MMscode: MMs02499275
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727493![]() | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.88 |
MMs01727494![]() | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.88 |
MMs01727495![]() | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.88 |
MMs01727496![]() | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.88 |
MMs01725149![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.85 |
MMs01726757![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.85 |
MMs01725126![]() | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.85 |









