Drugs present in MMsINC which are similar to the molecule MMscode: MMs02488816
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724808![]() | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.76 |
MMs01724839![]() | Oc1ncc(cc1N)-c1ccncc1 | 0.75 |
MMs01726858![]() | Ic1cc(I)c2c(nccc2)c1O | 0.74 |
MMs01727387![]() | S(=O)(=O)(Nc1ncccc1)c1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1 | 0.72 |
MMs01727136![]() | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.71 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.71 |
MMs01727138![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727139![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727140![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |
MMs01727137![]() | O1C(O)(COC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C1COC(=O)c1cccnc1 | 0.70 |