Drugs present in MMsINC which are similar to the molecule MMscode: MMs02483836
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727039![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01727040![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01727041![]() | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01726174![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.74 |
MMs01726184![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.74 |
MMs01726178![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.74 |
MMs01726180![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.74 |