Drugs present in MMsINC which are similar to the molecule MMscode: MMs02471948
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725866 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.80 |
MMs01725771 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.80 |
MMs01726044 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.80 |
MMs01725455 | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.80 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.79 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.76 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.76 |
MMs01726898 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.73 |
MMs01725453 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.73 |
MMs01725702 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.73 |
MMs01725336 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |