Drugs present in MMsINC which are similar to the molecule MMscode: MMs02465353
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.76 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.75 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.75 |
MMs01724898 | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.73 |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.72 |
MMs01726873 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01724816 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.70 |
MMs01724957 | s1c(ccc1C(C(O)=O)C)C(=O)c1ccccc1 | 0.70 |