Drugs present in MMsINC which are similar to the molecule MMscode: MMs02463350
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726379 | S1C2N(C(=O)C2NC(=O)CC#N)C(C(O)=O)=C(C1)COC(=O)C | 0.83 |
MMs01726373 | S1C2N(C(=O)C2NC(=O)CC#N)C(C(O)=O)=C(C1)COC(=O)C | 0.83 |
MMs01726375 | S1C2N(C(=O)C2NC(=O)CC#N)C(C(O)=O)=C(C1)COC(=O)C | 0.83 |
MMs01726377 | S1C2N(C(=O)C2NC(=O)CC#N)C(C(O)=O)=C(C1)COC(=O)C | 0.83 |
MMs01726243 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.73 |
MMs01726245 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.73 |
MMs01726247 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.73 |
MMs01726249 | S1C2N(C(=O)C2(OC)NC(=O)CSCC#N)C(C(O)=O)=C(C1)CSc1nnnn1C | 0.73 |