Drugs present in MMsINC which are similar to the molecule MMscode: MMs02460334
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725414 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.76 |
MMs01727373 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727374 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727375 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727376 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |