Drugs present in MMsINC which are similar to the molecule MMscode: MMs02459650
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724821![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.76 |
MMs01725755![]() | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.76 |
MMs01726110![]() | O(C(=O)c1ccc(cc1)C)c1cc(ccc1OC(=O)c1ccc(cc1)C)C(O)CNC(C)(C)C | 0.71 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |