Drugs present in MMsINC which are similar to the molecule MMscode: MMs02447343
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725859![]() | Oc1c(O)c(c2c(cc(C)c(-c3c(cc4c(c(C=O)c(O)c(O)c4C(C)C)c3O)C)c2O)c1C(C)C)C=O | 0.83 |
MMs01725788![]() | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.77 |
MMs01726458![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.76 |
MMs01726454![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.76 |
MMs01726456![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.76 |
MMs01726452![]() | O1C(C(O)C(O)C(O)C1CO)c1c(O)c(O)c2c(c1O)C(=O)c1c(cc(O)c(C(O)=O)c1C)C2=O | 0.76 |
MMs01724776![]() | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.76 |
MMs01725451![]() | S(Oc1cc2CCC3C4CCC(=O)C4(CCC3c2cc1)C)(O)(=O)=O | 0.72 |










