Drugs present in MMsINC which are similar to the molecule MMscode: MMs02446255
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727376 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.98 |
MMs01727375 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.98 |
MMs01727374 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.98 |
MMs01727373 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.98 |
MMs01726428 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.92 |
MMs01726429 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.92 |
MMs01726430 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.92 |
MMs01726431 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.92 |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.70 |