Drugs present in MMsINC which are similar to the molecule MMscode: MMs02444217
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727376 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727373 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727374 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727375 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.72 |
MMs01727367 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.71 |
MMs01727369 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.71 |
MMs01727371 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.71 |
MMs01727372 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.71 |