Drugs present in MMsINC which are similar to the molecule MMscode: MMs02438422
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725045 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.91 |
MMs01725046 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.91 |
MMs01725044 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.91 |
MMs01725414 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.78 |
MMs01725126 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.71 |
MMs01725149 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.71 |
MMs01726757 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.71 |