Drugs present in MMsINC which are similar to the molecule MMscode: MMs02434504
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725152![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)CCC2=O | 0.74 |
MMs01726500![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)C=CC2O | 0.73 |
MMs01727102![]() | O1C2C34C(C(N(CC3)CC=C)Cc3c4c1c(O)cc3)C=CC2O | 0.71 |
MMs01727061![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)C=CC2O | 0.71 |
MMs01725423![]() | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)CCC2=O | 0.71 |
MMs01727181![]() | O1C2C34CCN(C(Cc5c3c1c(OC)cc5)C4(O)CCC2=O)C | 0.70 |
MMs01726134![]() | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.70 |
MMs01726132![]() | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.70 |
MMs01726130![]() | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.70 |
MMs01726128![]() | O1C2C34C5(CC(C(O)(C(C)(C)C)C)C2(OC)CC5)C(N(CC3)CC2CC2)Cc2c4c1c(O)cc2 | 0.70 |
MMs01727094![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2O)CC1CCC1 | 0.70 |
MMs01727096![]() | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2O)CC1CCC1 | 0.70 |