Drugs present in MMsINC which are similar to the molecule MMscode: MMs02424538
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725388 | O(C(=O)N(CC)C)c1cc(ccc1)C(N(C)C)C | 0.81 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.75 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.74 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.74 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.73 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.73 |