Drugs present in MMsINC which are similar to the molecule MMscode: MMs02423216
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727735 | O1C(CO)C(O)C(O)C(NC)C1OC1C(O)(C=O)C(OC1OC1C(NC(N)=N)C(O)C(NC(N)=N)C(O)C1O)C | 0.72 |
MMs01727118 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727120 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727122 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727116 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(O)C(N)CC1N | 0.71 |
MMs01727369 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727371 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727372 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |
MMs01727367 | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.70 |