Drugs present in MMsINC which are similar to the molecule MMscode: MMs02416179
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725126 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.84 |
MMs01726757 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.84 |
MMs01725149 | FC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O | 0.84 |
MMs01727496 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.75 |
MMs01727493 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.75 |
MMs01727494 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.75 |
MMs01727495 | O1C(CO)C(N=[N+]=[N-])CC1N1C=C(C)C(=O)NC1=O | 0.75 |
MMs01725046 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.71 |
MMs01725045 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.71 |
MMs01725044 | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.71 |