Drugs present in MMsINC which are similar to the molecule MMscode: MMs02416145
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724771![]() | O(CC(O)CO)c1ccccc1C | 0.81 |
MMs01725109![]() | O(CC(O)CO)c1ccccc1C | 0.81 |
MMs01725080![]() | O(CC(O)COC(=O)N)c1ccccc1OC | 0.78 |
MMs01725081![]() | O(CC(O)COC(=O)N)c1ccccc1OC | 0.78 |
MMs01726736![]() | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.74 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.73 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.72 |
MMs01724736![]() | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.72 |
MMs01724842![]() | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.71 |