Drugs present in MMsINC which are similar to the molecule MMscode: MMs02413366
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725125![]() | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.86 |
MMs01725127![]() | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.86 |
MMs01725809![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725833![]() | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.73 |
MMs01725527![]() | O=C1NC(=Nc2n(cnc12)COCCOC(=O)C(N)C(C)C)N | 0.72 |
MMs01725836![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.70 |
MMs01725834![]() | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.70 |