Drugs present in MMsINC which are similar to the molecule MMscode: MMs02412422
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726013 | O(C(=O)C(CCC)CCC)C1CC2[N+](C(C1)CC2)(C)C | 0.77 |
MMs01727212 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCC)CC | 0.71 |
MMs01727214 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCC)CC | 0.71 |
MMs01727216 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCC)CC | 0.71 |
MMs01727218 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCC)CC | 0.71 |