Drugs present in MMsINC which are similar to the molecule MMscode: MMs02411514
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.85 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.85 |
MMs01724827 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)CN(CCO)C)C | 0.72 |
MMs01725082 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.72 |
MMs01725083 | O=C1N(C)C(=O)N(c2ncn(c12)CC(O)C)C | 0.72 |