Drugs present in MMsINC which are similar to the molecule MMscode: MMs02409807
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725656![]() | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.83 |
MMs01724935![]() | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.77 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.70 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |
MMs01725008![]() | S1c2c(N(c3c1cccc3)CCC[NH+](C)C)cccc2 | 0.70 |