Drugs present in MMsINC which are similar to the molecule MMscode: MMs02403539
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.80 |
MMs01724806 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.72 |
MMs01725741 | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.72 |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.71 |
MMs01726828 | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.70 |