Drugs present in MMsINC which are similar to the molecule MMscode: MMs02400323
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727358![]() | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727359![]() | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727360![]() | OC1CCC2(C(CC=C3C4CCC(C(CC/C(=C\C)/C(C)C)C)C4(CCC23)C)C1C)C | 0.72 |
MMs01727361![]() | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727362![]() | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727363![]() | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |
MMs01727364![]() | OC1CC2=CCC3C4CCC(C(CCC(C(C)C)CC)C)C4(CCC3C2(CC1)C)C | 0.71 |