Drugs present in MMsINC which are similar to the molecule MMscode: MMs02393356
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727583 | O1C(CO)C(O)C(O)C(NC)C1OC1C(O)(CO)C(OC1OC1C(NC(N)=N)C(O)C(NC(N)=N)C(O)C1O)C | 0.76 |
MMs01726021 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726023 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726025 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726027 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |