Drugs present in MMsINC which are similar to the molecule MMscode: MMs02390177
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727031![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727033![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727035![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727037![]() | OC1C(O)C(O)CN(CCO)C1CO | 0.73 |
MMs01727373![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727374![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727375![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727376![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |