Drugs present in MMsINC which are similar to the molecule MMscode: MMs02377479
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.79 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.79 |
MMs01724825 | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.72 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.70 |