Drugs present in MMsINC which are similar to the molecule MMscode: MMs02369136
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.75 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.75 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.74 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01727042![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.73 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01724860![]() | Clc1ccccc1CC([NH3+])(C)C | 0.72 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.71 |
MMs01725712![]() | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.70 |