Drugs present in MMsINC which are similar to the molecule MMscode: MMs02362651
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725832![]() | O=C1NC(=O)NC(=O)C1(CC)CC | 0.89 |
MMs01725856![]() | O=C1NC(=O)NC(=O)C1(C(CC)C)CC | 0.82 |
MMs01725405![]() | O=C1NC(=O)NC(=O)C1(C(CCC)C)CC | 0.79 |
MMs01725850![]() | O=C1NC(=O)NC(=O)C1(C(C)C)CC=C | 0.73 |
MMs01726136![]() | O=C1NC(=O)NC(=O)C1(CC(C)C)CC=C | 0.72 |
MMs01727426![]() | S=C1NC(=O)C(C(CCC)C)(CC)C(=O)N1 | 0.71 |
MMs01727427![]() | S=C1NC(=O)C(C(CCC)C)(CC)C(=O)N1 | 0.71 |
MMs01725802![]() | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.71 |
MMs01727397![]() | O=C1NC(=O)NC(=O)C1(C(CC)C)CC=C | 0.71 |