Drugs present in MMsINC which are similar to the molecule MMscode: MMs02362434
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725712![]() | S(C(=O)C(c1ccccc1)c1ccccc1)CCN(CC)CC | 0.77 |
MMs01724995![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.76 |
MMs01727042![]() | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.76 |
MMs01725564![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.73 |
MMs01725565![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.73 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.70 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.70 |